C23H22ClN3O4 — CID 55677963
4-chloro-N-[2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]phenyl]benzamide (PubChem CID 55677963) has the molecular formula C23H22ClN3O4 and a molecular weight of 439.90 g/mol. Its IUPAC name is 4-chloro-N-[2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]phenyl]benzamide.
| Compound Name | 4-chloro-N-[2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 55677963 |
| Molecular Formula | C23H22ClN3O4 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 4-chloro-N-[2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]phenyl]benzamide |
| SMILES | O=C(CN1C(=O)C2CCCCC2C1=O)Nc1ccccc1NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22ClN3O4/c24-15-11-9-14(10-12-15)21(29)26-19-8-4-3-7-18(19)25-20(28)13-27-22(30)16-5-1-2-6-17(16)23(27)31/h3-4,7-12,16-17H,1-2,5-6,13H2,(H,25,28)(H,26,29) |
| InChIKey | TVBJBSLNXBFLHY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|