C20H20N4O3 — CID 134009215
2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(2-phenylpyrimidin-5-yl)acetamide (PubChem CID 134009215) has the molecular formula C20H20N4O3 and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(2-phenylpyrimidin-5-yl)acetamide.
| Compound Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(2-phenylpyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 134009215 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(2-phenylpyrimidin-5-yl)acetamide |
| SMILES | O=C(CN1C(=O)C2CCCCC2C1=O)Nc1cnc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C20H20N4O3/c25-17(12-24-19(26)15-8-4-5-9-16(15)20(24)27)23-14-10-21-18(22-11-14)13-6-2-1-3-7-13/h1-3,6-7,10-11,15-16H,4-5,8-9,12H2,(H,23,25) |
| InChIKey | MFBKMQOZNJIVQB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|