C16H19N3O3 — CID 98385049
2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(5-methyl-2-pyridinyl)acetamide (PubChem CID 98385049) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(5-methyl-2-pyridinyl)acetamide.
| Compound Name | 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(5-methyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 98385049 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(5-methyl-2-pyridinyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)[C@H]3CCCC[C@@H]3C2=O)nc1 |
| InChI | InChI=1S/C16H19N3O3/c1-10-6-7-13(17-8-10)18-14(20)9-19-15(21)11-4-2-3-5-12(11)16(19)22/h6-8,11-12H,2-5,9H2,1H3,(H,17,18,20)/t11-,12-/m0/s1 |
| InChIKey | DQGUCBMVTJLPTL-RYUDHWBXSA-N |
| XLogP | 1.50 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|