C22H24N4O3S — CID 92882745
N-(5-methyl-2-pyridinyl)-2-[(2R)-3-oxo-2-(piperidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide (PubChem CID 92882745) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is N-(5-methyl-2-pyridinyl)-2-[(2R)-3-oxo-2-(piperidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide.
| Compound Name | N-(5-methyl-2-pyridinyl)-2-[(2R)-3-oxo-2-(piperidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide |
|---|---|
| PubChem CID | 92882745 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-(5-methyl-2-pyridinyl)-2-[(2R)-3-oxo-2-(piperidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)[C@@H](C(=O)N3CCCCC3)Sc3ccccc32)nc1 |
| InChI | InChI=1S/C22H24N4O3S/c1-15-9-10-18(23-13-15)24-19(27)14-26-16-7-3-4-8-17(16)30-20(22(26)29)21(28)25-11-5-2-6-12-25/h3-4,7-10,13,20H,2,5-6,11-12,14H2,1H3,(H,23,24,27)/t20-/m1/s1 |
| InChIKey | QORXFLRRPUMOIW-HXUWFJFHSA-N |
| XLogP | 2.85 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|