C24H25N3O5S — CID 92882874
methyl 4-[[2-[(2S)-3-oxo-2-(piperidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetyl]amino]benzoate (PubChem CID 92882874) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is methyl 4-[[2-[(2S)-3-oxo-2-(piperidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[(2S)-3-oxo-2-(piperidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 92882874 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | methyl 4-[[2-[(2S)-3-oxo-2-(piperidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CN2C(=O)[C@H](C(=O)N3CCCCC3)Sc3ccccc32)cc1 |
| InChI | InChI=1S/C24H25N3O5S/c1-32-24(31)16-9-11-17(12-10-16)25-20(28)15-27-18-7-3-4-8-19(18)33-21(23(27)30)22(29)26-13-5-2-6-14-26/h3-4,7-12,21H,2,5-6,13-15H2,1H3,(H,25,28)/t21-/m0/s1 |
| InChIKey | AGPNRIFKMWNWKN-NRFANRHFSA-N |
| XLogP | 2.93 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|