C24H27N3O3S2 — CID 92882967
2-[(2R)-2-(azepane-1-carbonyl)-3-oxo-1,4-benzothiazin-4-yl]-N-(3-methylsulfanylphenyl)acetamide (PubChem CID 92882967) has the molecular formula C24H27N3O3S2 and a molecular weight of 469.63 g/mol. Its IUPAC name is 2-[(2R)-2-(azepane-1-carbonyl)-3-oxo-1,4-benzothiazin-4-yl]-N-(3-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[(2R)-2-(azepane-1-carbonyl)-3-oxo-1,4-benzothiazin-4-yl]-N-(3-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 92882967 |
| Molecular Formula | C24H27N3O3S2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 2-[(2R)-2-(azepane-1-carbonyl)-3-oxo-1,4-benzothiazin-4-yl]-N-(3-methylsulfanylphenyl)acetamide |
| SMILES | CSc1cccc(NC(=O)CN2C(=O)[C@@H](C(=O)N3CCCCCC3)Sc3ccccc32)c1 |
| InChI | InChI=1S/C24H27N3O3S2/c1-31-18-10-8-9-17(15-18)25-21(28)16-27-19-11-4-5-12-20(19)32-22(24(27)30)23(29)26-13-6-2-3-7-14-26/h4-5,8-12,15,22H,2-3,6-7,13-14,16H2,1H3,(H,25,28)/t22-/m1/s1 |
| InChIKey | FUHKOTGRDBTATO-JOCHJYFZSA-N |
| XLogP | 4.26 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|