C22H22BrN3O3S — CID 46387761
N-(4-bromo-3-methylphenyl)-2-[3-oxo-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide (PubChem CID 46387761) has the molecular formula C22H22BrN3O3S and a molecular weight of 488.41 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-[3-oxo-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-[3-oxo-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide |
|---|---|
| PubChem CID | 46387761 |
| Molecular Formula | C22H22BrN3O3S |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-[3-oxo-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide |
| SMILES | Cc1cc(NC(=O)CN2C(=O)C(C(=O)N3CCCC3)Sc3ccccc32)ccc1Br |
| InChI | InChI=1S/C22H22BrN3O3S/c1-14-12-15(8-9-16(14)23)24-19(27)13-26-17-6-2-3-7-18(17)30-20(22(26)29)21(28)25-10-4-5-11-25/h2-3,6-9,12,20H,4-5,10-11,13H2,1H3,(H,24,27) |
| InChIKey | RVRITVINIHDMJA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|