C21H19F2N3O3S — CID 92882696
N-(3,4-difluorophenyl)-2-[(2S)-3-oxo-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide (PubChem CID 92882696) has the molecular formula C21H19F2N3O3S and a molecular weight of 431.46 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-[(2S)-3-oxo-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-[(2S)-3-oxo-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide |
|---|---|
| PubChem CID | 92882696 |
| Molecular Formula | C21H19F2N3O3S |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-[(2S)-3-oxo-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide |
| SMILES | O=C(CN1C(=O)[C@H](C(=O)N2CCCC2)Sc2ccccc21)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H19F2N3O3S/c22-14-8-7-13(11-15(14)23)24-18(27)12-26-16-5-1-2-6-17(16)30-19(21(26)29)20(28)25-9-3-4-10-25/h1-2,5-8,11,19H,3-4,9-10,12H2,(H,24,27)/t19-/m0/s1 |
| InChIKey | BEQJCHFNHFGWHJ-IBGZPJMESA-N |
| XLogP | 3.03 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|