C21H20BrN3O3S — CID 92882719
N-(3-bromophenyl)-2-[(2R)-3-oxo-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide (PubChem CID 92882719) has the molecular formula C21H20BrN3O3S and a molecular weight of 474.38 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-[(2R)-3-oxo-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide.
| Compound Name | N-(3-bromophenyl)-2-[(2R)-3-oxo-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide |
|---|---|
| PubChem CID | 92882719 |
| Molecular Formula | C21H20BrN3O3S |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | N-(3-bromophenyl)-2-[(2R)-3-oxo-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide |
| SMILES | O=C(CN1C(=O)[C@@H](C(=O)N2CCCC2)Sc2ccccc21)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C21H20BrN3O3S/c22-14-6-5-7-15(12-14)23-18(26)13-25-16-8-1-2-9-17(16)29-19(21(25)28)20(27)24-10-3-4-11-24/h1-2,5-9,12,19H,3-4,10-11,13H2,(H,23,26)/t19-/m1/s1 |
| InChIKey | JLUUDYGKNWIDFK-LJQANCHMSA-N |
| XLogP | 3.52 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|