C25H29N3O3S — CID 46387946
2-[2-(azepane-1-carbonyl)-3-oxo-1,4-benzothiazin-4-yl]-N-[(3-methylphenyl)methyl]acetamide (PubChem CID 46387946) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is 2-[2-(azepane-1-carbonyl)-3-oxo-1,4-benzothiazin-4-yl]-N-[(3-methylphenyl)methyl]acetamide.
| Compound Name | 2-[2-(azepane-1-carbonyl)-3-oxo-1,4-benzothiazin-4-yl]-N-[(3-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 46387946 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 2-[2-(azepane-1-carbonyl)-3-oxo-1,4-benzothiazin-4-yl]-N-[(3-methylphenyl)methyl]acetamide |
| SMILES | Cc1cccc(CNC(=O)CN2C(=O)C(C(=O)N3CCCCCC3)Sc3ccccc32)c1 |
| InChI | InChI=1S/C25H29N3O3S/c1-18-9-8-10-19(15-18)16-26-22(29)17-28-20-11-4-5-12-21(20)32-23(25(28)31)24(30)27-13-6-2-3-7-14-27/h4-5,8-12,15,23H,2-3,6-7,13-14,16-17H2,1H3,(H,26,29) |
| InChIKey | JACTYPGDAZYGQG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|