C19H25ClN6O — CID 19520547
2-(4-chloro-5-methylpyrazol-1-yl)-N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]acetamide (PubChem CID 19520547) has the molecular formula C19H25ClN6O and a molecular weight of 388.90 g/mol. Its IUPAC name is 2-(4-chloro-5-methylpyrazol-1-yl)-N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]acetamide.
| Compound Name | 2-(4-chloro-5-methylpyrazol-1-yl)-N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]acetamide |
|---|---|
| PubChem CID | 19520547 |
| Molecular Formula | C19H25ClN6O |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-(4-chloro-5-methylpyrazol-1-yl)-N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]acetamide |
| SMILES | CCN(CC)CCn1c(NC(=O)Cn2ncc(Cl)c2C)nc2ccccc21 |
| InChI | InChI=1S/C19H25ClN6O/c1-4-24(5-2)10-11-25-17-9-7-6-8-16(17)22-19(25)23-18(27)13-26-14(3)15(20)12-21-26/h6-9,12H,4-5,10-11,13H2,1-3H3,(H,22,23,27) |
| InChIKey | QCFQIFUBZCZPMI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |