C19H26N6O — CID 19280963
N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-1-ethylpyrazole-4-carboxamide (PubChem CID 19280963) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-1-ethylpyrazole-4-carboxamide.
| Compound Name | N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-1-ethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19280963 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-1-ethylpyrazole-4-carboxamide |
| SMILES | CCN(CC)CCn1c(NC(=O)c2cnn(CC)c2)nc2ccccc21 |
| InChI | InChI=1S/C19H26N6O/c1-4-23(5-2)11-12-25-17-10-8-7-9-16(17)21-19(25)22-18(26)15-13-20-24(6-3)14-15/h7-10,13-14H,4-6,11-12H2,1-3H3,(H,21,22,26) |
| InChIKey | IZDDKFVLGLWSBT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |