C21H27N5OS — CID 60567418
N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-2-ethylsulfanylpyridine-4-carboxamide (PubChem CID 60567418) has the molecular formula C21H27N5OS and a molecular weight of 397.55 g/mol. Its IUPAC name is N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-2-ethylsulfanylpyridine-4-carboxamide.
| Compound Name | N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-2-ethylsulfanylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 60567418 |
| Molecular Formula | C21H27N5OS |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-2-ethylsulfanylpyridine-4-carboxamide |
| SMILES | CCSc1cc(C(=O)Nc2nc3ccccc3n2CCN(CC)CC)ccn1 |
| InChI | InChI=1S/C21H27N5OS/c1-4-25(5-2)13-14-26-18-10-8-7-9-17(18)23-21(26)24-20(27)16-11-12-22-19(15-16)28-6-3/h7-12,15H,4-6,13-14H2,1-3H3,(H,23,24,27) |
| InChIKey | BLEBEYXUHFVVKD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |