C22H26FN5O2 — CID 60567449
5-acetamido-N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-2-fluorobenzamide (PubChem CID 60567449) has the molecular formula C22H26FN5O2 and a molecular weight of 411.48 g/mol. Its IUPAC name is 5-acetamido-N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-2-fluorobenzamide.
| Compound Name | 5-acetamido-N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 60567449 |
| Molecular Formula | C22H26FN5O2 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 5-acetamido-N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-2-fluorobenzamide |
| SMILES | CCN(CC)CCn1c(NC(=O)c2cc(NC(C)=O)ccc2F)nc2ccccc21 |
| InChI | InChI=1S/C22H26FN5O2/c1-4-27(5-2)12-13-28-20-9-7-6-8-19(20)25-22(28)26-21(30)17-14-16(24-15(3)29)10-11-18(17)23/h6-11,14H,4-5,12-13H2,1-3H3,(H,24,29)(H,25,26,30) |
| InChIKey | ALXIBMWTPQQOIQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |