C20H22F2N4O — CID 30178740
N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-2,5-difluorobenzamide (PubChem CID 30178740) has the molecular formula C20H22F2N4O and a molecular weight of 372.42 g/mol. Its IUPAC name is N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-2,5-difluorobenzamide.
| Compound Name | N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 30178740 |
| Molecular Formula | C20H22F2N4O |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-2,5-difluorobenzamide |
| SMILES | CCN(CC)CCn1c(NC(=O)c2cc(F)ccc2F)nc2ccccc21 |
| InChI | InChI=1S/C20H22F2N4O/c1-3-25(4-2)11-12-26-18-8-6-5-7-17(18)23-20(26)24-19(27)15-13-14(21)9-10-16(15)22/h5-10,13H,3-4,11-12H2,1-2H3,(H,23,24,27) |
| InChIKey | SPICJIQOJBACPN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |