C23H26N6O2 — CID 112807743
N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-4-hydroxy-1-phenylpyrazole-3-carboxamide (PubChem CID 112807743) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-4-hydroxy-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-4-hydroxy-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 112807743 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-4-hydroxy-1-phenylpyrazole-3-carboxamide |
| SMILES | CCN(CC)CCn1c(NC(=O)c2nn(-c3ccccc3)cc2O)nc2ccccc21 |
| InChI | InChI=1S/C23H26N6O2/c1-3-27(4-2)14-15-28-19-13-9-8-12-18(19)24-23(28)25-22(31)21-20(30)16-29(26-21)17-10-6-5-7-11-17/h5-13,16,30H,3-4,14-15H2,1-2H3,(H,24,25,31) |
| InChIKey | JIQLVBHYHKHCKL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |