C29H30N6O2 — CID 55365598
N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide (PubChem CID 55365598) has the molecular formula C29H30N6O2 and a molecular weight of 494.60 g/mol. Its IUPAC name is N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide.
| Compound Name | N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide |
|---|---|
| PubChem CID | 55365598 |
| Molecular Formula | C29H30N6O2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide |
| SMILES | CCN(CC)CCn1c(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)nc2ccccc21 |
| InChI | InChI=1S/C29H30N6O2/c1-4-33(5-2)18-19-34-26-13-9-8-12-25(26)31-29(34)32-27(36)21-14-16-22(17-15-21)35-20(3)30-24-11-7-6-10-23(24)28(35)37/h6-17H,4-5,18-19H2,1-3H3,(H,31,32,36) |
| InChIKey | UUSFGDAZKUBNRA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |