C15H24Cl2N4O — CID 44888954
1-ethyl-N-(2-morpholin-4-ylethyl)benzimidazol-2-amine;dihydrochloride (PubChem CID 44888954) has the molecular formula C15H24Cl2N4O and a molecular weight of 347.29 g/mol. Its IUPAC name is 1-ethyl-N-(2-morpholin-4-ylethyl)benzimidazol-2-amine;dihydrochloride.
| Compound Name | 1-ethyl-N-(2-morpholin-4-ylethyl)benzimidazol-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 44888954 |
| Molecular Formula | C15H24Cl2N4O |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 1-ethyl-N-(2-morpholin-4-ylethyl)benzimidazol-2-amine;dihydrochloride |
| SMILES | CCn1c(NCCN2CCOCC2)nc2ccccc21.Cl.Cl |
| InChI | InChI=1S/C15H22N4O.2ClH/c1-2-19-14-6-4-3-5-13(14)17-15(19)16-7-8-18-9-11-20-12-10-18;;/h3-6H,2,7-12H2,1H3,(H,16,17);2*1H |
| InChIKey | LTZZPNQRKHPSSG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |