C18H29N5 — CID 924766
1-(3-methylbutyl)-N-(2-piperazin-1-ylethyl)benzimidazol-2-amine (PubChem CID 924766) has the molecular formula C18H29N5 and a molecular weight of 315.46 g/mol. Its IUPAC name is 1-(3-methylbutyl)-N-(2-piperazin-1-ylethyl)benzimidazol-2-amine.
| Compound Name | 1-(3-methylbutyl)-N-(2-piperazin-1-ylethyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 924766 |
| Molecular Formula | C18H29N5 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | 1-(3-methylbutyl)-N-(2-piperazin-1-ylethyl)benzimidazol-2-amine |
| SMILES | CC(C)CCn1c(NCCN2CCNCC2)nc2ccccc21 |
| InChI | InChI=1S/C18H29N5/c1-15(2)7-11-23-17-6-4-3-5-16(17)21-18(23)20-10-14-22-12-8-19-9-13-22/h3-6,15,19H,7-14H2,1-2H3,(H,20,21) |
| InChIKey | CMMQOCDLBQMGBG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |