C18H26N4O2 — CID 56877047
4-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]piperazine-2-carboxylic acid (PubChem CID 56877047) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 4-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]piperazine-2-carboxylic acid.
| Compound Name | 4-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 56877047 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 4-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]piperazine-2-carboxylic acid |
| SMILES | CC(C)CCn1c(CN2CCNC(C(=O)O)C2)nc2ccccc21 |
| InChI | InChI=1S/C18H26N4O2/c1-13(2)7-9-22-16-6-4-3-5-14(16)20-17(22)12-21-10-8-19-15(11-21)18(23)24/h3-6,13,15,19H,7-12H2,1-2H3,(H,23,24) |
| InChIKey | VEFJULBNMWSGEQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |