C21H29ClN4O — CID 6603193
1-[2-(diethylamino)ethyl]-N-[(3-methoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride (PubChem CID 6603193) has the molecular formula C21H29ClN4O and a molecular weight of 388.94 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-N-[(3-methoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride.
| Compound Name | 1-[2-(diethylamino)ethyl]-N-[(3-methoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 6603193 |
| Molecular Formula | C21H29ClN4O |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-N-[(3-methoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride |
| SMILES | CCN(CC)CCn1c(NCc2cccc(OC)c2)nc2ccccc21.Cl |
| InChI | InChI=1S/C21H28N4O.ClH/c1-4-24(5-2)13-14-25-20-12-7-6-11-19(20)23-21(25)22-16-17-9-8-10-18(15-17)26-3;/h6-12,15H,4-5,13-14,16H2,1-3H3,(H,22,23);1H |
| InChIKey | YBTPOERZSYYFKF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |