C24H30N4O3 — CID 18209237
(E)-N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-3-(3,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 18209237) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is (E)-N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-3-(3,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-3-(3,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18209237 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (E)-N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-3-(3,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | CCN(CC)CCn1c(NC(=O)/C=C/c2cc(OC)cc(OC)c2)nc2ccccc21 |
| InChI | InChI=1S/C24H30N4O3/c1-5-27(6-2)13-14-28-22-10-8-7-9-21(22)25-24(28)26-23(29)12-11-18-15-19(30-3)17-20(16-18)31-4/h7-12,15-17H,5-6,13-14H2,1-4H3,(H,25,26,29)/b12-11+ |
| InChIKey | YUFBXINXQRJZOO-VAWYXSNFSA-N |
| XLogP | 4.05 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|