C18H23N7O4 — CID 19510904
N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 19510904) has the molecular formula C18H23N7O4 and a molecular weight of 401.43 g/mol. Its IUPAC name is N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19510904 |
| Molecular Formula | C18H23N7O4 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | CCN(CC)CCn1c(NC(=O)c2[nH]nc(OC)c2[N+](=O)[O-])nc2ccccc21 |
| InChI | InChI=1S/C18H23N7O4/c1-4-23(5-2)10-11-24-13-9-7-6-8-12(13)19-18(24)20-16(26)14-15(25(27)28)17(29-3)22-21-14/h6-9H,4-5,10-11H2,1-3H3,(H,21,22)(H,19,20,26) |
| InChIKey | XQSVKGLWSKHZRQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|