C20H24N10O3 — CID 19265700
N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide (PubChem CID 19265700) has the molecular formula C20H24N10O3 and a molecular weight of 452.48 g/mol. Its IUPAC name is N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19265700 |
| Molecular Formula | C20H24N10O3 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | N-[1-[2-(diethylamino)ethyl]benzimidazol-2-yl]-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide |
| SMILES | CCN(CC)CCn1c(NC(=O)c2ccn(Cn3cnc([N+](=O)[O-])n3)n2)nc2ccccc21 |
| InChI | InChI=1S/C20H24N10O3/c1-3-26(4-2)11-12-29-17-8-6-5-7-15(17)22-20(29)23-18(31)16-9-10-27(24-16)14-28-13-21-19(25-28)30(32)33/h5-10,13H,3-4,11-12,14H2,1-2H3,(H,22,23,31) |
| InChIKey | ZRLAVHJMCQNOHJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|