C14H13N7O4 — CID 19265731
N-(3-methoxyphenyl)-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide (PubChem CID 19265731) has the molecular formula C14H13N7O4 and a molecular weight of 343.30 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-(3-methoxyphenyl)-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19265731 |
| Molecular Formula | C14H13N7O4 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-(3-methoxyphenyl)-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide |
| SMILES | COc1cccc(NC(=O)c2ccn(Cn3cnc([N+](=O)[O-])n3)n2)c1 |
| InChI | InChI=1S/C14H13N7O4/c1-25-11-4-2-3-10(7-11)16-13(22)12-5-6-19(17-12)9-20-8-15-14(18-20)21(23)24/h2-8H,9H2,1H3,(H,16,22) |
| InChIKey | NINZDUZXANTXJM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|