C14H11F2N7O4 — CID 19265825
N-[2-(difluoromethoxy)phenyl]-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide (PubChem CID 19265825) has the molecular formula C14H11F2N7O4 and a molecular weight of 379.28 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19265825 |
| Molecular Formula | C14H11F2N7O4 |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1OC(F)F)c1ccn(Cn2cnc([N+](=O)[O-])n2)n1 |
| InChI | InChI=1S/C14H11F2N7O4/c15-13(16)27-11-4-2-1-3-9(11)18-12(24)10-5-6-21(19-10)8-22-7-17-14(20-22)23(25)26/h1-7,13H,8H2,(H,18,24) |
| InChIKey | GEVCSMQWMIDFET-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|