C19H23BN3O2 — CID 70326426
CID 70326426 (PubChem CID 70326426) has the molecular formula C19H23BN3O2 and a molecular weight of 336.22 g/mol.
| Compound Name | CID 70326426 |
|---|---|
| PubChem CID | 70326426 |
| Molecular Formula | C19H23BN3O2 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | — |
| SMILES | COc1ccc(Nc2nc3ccccc3n2CCCCC[B]O)cc1 |
| InChI | InChI=1S/C19H23BN3O2/c1-25-16-11-9-15(10-12-16)21-19-22-17-7-3-4-8-18(17)23(19)14-6-2-5-13-20-24/h3-4,7-12,24H,2,5-6,13-14H2,1H3,(H,21,22) |
| InChIKey | PXMGMEHNCCVHKL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|