C10H14O4S — CID 103378021
2-(3-hydroxypropoxy)-2-(3-methylthiophen-2-yl)acetic acid (PubChem CID 103378021) has the molecular formula C10H14O4S and a molecular weight of 230.28 g/mol. Its IUPAC name is 2-(3-hydroxypropoxy)-2-(3-methylthiophen-2-yl)acetic acid.
| Compound Name | 2-(3-hydroxypropoxy)-2-(3-methylthiophen-2-yl)acetic acid |
|---|---|
| PubChem CID | 103378021 |
| Molecular Formula | C10H14O4S |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-(3-hydroxypropoxy)-2-(3-methylthiophen-2-yl)acetic acid |
| SMILES | Cc1ccsc1C(OCCCO)C(=O)O |
| InChI | InChI=1S/C10H14O4S/c1-7-3-6-15-9(7)8(10(12)13)14-5-2-4-11/h3,6,8,11H,2,4-5H2,1H3,(H,12,13) |
| InChIKey | ZVCAVGXMNJVXTP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|