C9H13NO2S — CID 116860798
N-[2-hydroxy-1-(3-methylthiophen-2-yl)ethyl]acetamide (PubChem CID 116860798) has the molecular formula C9H13NO2S and a molecular weight of 199.28 g/mol. Its IUPAC name is N-[2-hydroxy-1-(3-methylthiophen-2-yl)ethyl]acetamide.
| Compound Name | N-[2-hydroxy-1-(3-methylthiophen-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 116860798 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | N-[2-hydroxy-1-(3-methylthiophen-2-yl)ethyl]acetamide |
| SMILES | CC(=O)NC(CO)c1sccc1C |
| InChI | InChI=1S/C9H13NO2S/c1-6-3-4-13-9(6)8(5-11)10-7(2)12/h3-4,8,11H,5H2,1-2H3,(H,10,12) |
| InChIKey | QGMRLCGQDKOSSC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |