C10H18N2OS — CID 65378659
3-[[2-amino-1-(3-methylthiophen-2-yl)ethyl]amino]propan-1-ol (PubChem CID 65378659) has the molecular formula C10H18N2OS and a molecular weight of 214.33 g/mol. Its IUPAC name is 3-[[2-amino-1-(3-methylthiophen-2-yl)ethyl]amino]propan-1-ol.
| Compound Name | 3-[[2-amino-1-(3-methylthiophen-2-yl)ethyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 65378659 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 3-[[2-amino-1-(3-methylthiophen-2-yl)ethyl]amino]propan-1-ol |
| SMILES | Cc1ccsc1C(CN)NCCCO |
| InChI | InChI=1S/C10H18N2OS/c1-8-3-6-14-10(8)9(7-11)12-4-2-5-13/h3,6,9,12-13H,2,4-5,7,11H2,1H3 |
| InChIKey | BZQTYXHYXXLUCI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|