C12H15FO5 — CID 83224437
2-(3-fluoro-4-methoxyphenyl)-2-(3-hydroxypropoxy)acetic acid (PubChem CID 83224437) has the molecular formula C12H15FO5 and a molecular weight of 258.24 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)-2-(3-hydroxypropoxy)acetic acid.
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)-2-(3-hydroxypropoxy)acetic acid |
|---|---|
| PubChem CID | 83224437 |
| Molecular Formula | C12H15FO5 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)-2-(3-hydroxypropoxy)acetic acid |
| SMILES | COc1ccc(C(OCCCO)C(=O)O)cc1F |
| InChI | InChI=1S/C12H15FO5/c1-17-10-4-3-8(7-9(10)13)11(12(15)16)18-6-2-5-14/h3-4,7,11,14H,2,5-6H2,1H3,(H,15,16) |
| InChIKey | KGODOEBCSSYCFF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|