C11H12ClFO4 — CID 83224161
2-(3-chloro-4-fluorophenyl)-2-(3-hydroxypropoxy)acetic acid (PubChem CID 83224161) has the molecular formula C11H12ClFO4 and a molecular weight of 262.66 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-2-(3-hydroxypropoxy)acetic acid.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-2-(3-hydroxypropoxy)acetic acid |
|---|---|
| PubChem CID | 83224161 |
| Molecular Formula | C11H12ClFO4 |
| Molecular Weight | 262.66 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-2-(3-hydroxypropoxy)acetic acid |
| SMILES | O=C(O)C(OCCCO)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C11H12ClFO4/c12-8-6-7(2-3-9(8)13)10(11(15)16)17-5-1-4-14/h2-3,6,10,14H,1,4-5H2,(H,15,16) |
| InChIKey | UBDMWDUBWGLSCP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.66 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|