C10H8ClF3O3 — CID 67067400
2-(2-chloroethoxy)-2-(3,4,5-trifluorophenyl)acetic acid (PubChem CID 67067400) has the molecular formula C10H8ClF3O3 and a molecular weight of 268.62 g/mol. Its IUPAC name is 2-(2-chloroethoxy)-2-(3,4,5-trifluorophenyl)acetic acid.
| Compound Name | 2-(2-chloroethoxy)-2-(3,4,5-trifluorophenyl)acetic acid |
|---|---|
| PubChem CID | 67067400 |
| Molecular Formula | C10H8ClF3O3 |
| Molecular Weight | 268.62 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2-(2-chloroethoxy)-2-(3,4,5-trifluorophenyl)acetic acid |
| SMILES | O=C(O)C(OCCCl)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H8ClF3O3/c11-1-2-17-9(10(15)16)5-3-6(12)8(14)7(13)4-5/h3-4,9H,1-2H2,(H,15,16) |
| InChIKey | YDSWOZKMXZMDNI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.62 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|