C11H12Cl2O4 — CID 83224723
2-(3,5-dichlorophenyl)-2-(3-hydroxypropoxy)acetic acid (PubChem CID 83224723) has the molecular formula C11H12Cl2O4 and a molecular weight of 279.12 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-2-(3-hydroxypropoxy)acetic acid.
| Compound Name | 2-(3,5-dichlorophenyl)-2-(3-hydroxypropoxy)acetic acid |
|---|---|
| PubChem CID | 83224723 |
| Molecular Formula | C11H12Cl2O4 |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-2-(3-hydroxypropoxy)acetic acid |
| SMILES | O=C(O)C(OCCCO)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2O4/c12-8-4-7(5-9(13)6-8)10(11(15)16)17-3-1-2-14/h4-6,10,14H,1-3H2,(H,15,16) |
| InChIKey | NDDAGGIWRQLBLI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|