C13H18O4 — CID 83224254
2-(2,6-dimethylphenyl)-2-(3-hydroxypropoxy)acetic acid (PubChem CID 83224254) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-2-(3-hydroxypropoxy)acetic acid.
| Compound Name | 2-(2,6-dimethylphenyl)-2-(3-hydroxypropoxy)acetic acid |
|---|---|
| PubChem CID | 83224254 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-2-(3-hydroxypropoxy)acetic acid |
| SMILES | Cc1cccc(C)c1C(OCCCO)C(=O)O |
| InChI | InChI=1S/C13H18O4/c1-9-5-3-6-10(2)11(9)12(13(15)16)17-8-4-7-14/h3,5-6,12,14H,4,7-8H2,1-2H3,(H,15,16) |
| InChIKey | FLEHMHGWQKIHLL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|