C15H22O3 — CID 133245185
2-butoxy-3-(2,6-dimethylphenyl)propanoic acid (PubChem CID 133245185) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-butoxy-3-(2,6-dimethylphenyl)propanoic acid.
| Compound Name | 2-butoxy-3-(2,6-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 133245185 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2-butoxy-3-(2,6-dimethylphenyl)propanoic acid |
| SMILES | CCCCOC(Cc1c(C)cccc1C)C(=O)O |
| InChI | InChI=1S/C15H22O3/c1-4-5-9-18-14(15(16)17)10-13-11(2)7-6-8-12(13)3/h6-8,14H,4-5,9-10H2,1-3H3,(H,16,17) |
| InChIKey | VRISNXUOBZWOKB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|