C13H16Cl2O3 — CID 100540443
(2S)-2-butoxy-3-(3,4-dichlorophenyl)propanoic acid (PubChem CID 100540443) has the molecular formula C13H16Cl2O3 and a molecular weight of 291.17 g/mol. Its IUPAC name is (2S)-2-butoxy-3-(3,4-dichlorophenyl)propanoic acid.
| Compound Name | (2S)-2-butoxy-3-(3,4-dichlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 100540443 |
| Molecular Formula | C13H16Cl2O3 |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | (2S)-2-butoxy-3-(3,4-dichlorophenyl)propanoic acid |
| SMILES | CCCCO[C@@H](Cc1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C13H16Cl2O3/c1-2-3-6-18-12(13(16)17)8-9-4-5-10(14)11(15)7-9/h4-5,7,12H,2-3,6,8H2,1H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | JZNMNVDLOAPOPH-LBPRGKRZSA-N |
| XLogP | 3.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|