C22H22F3NO5 — CID 142176289
2-butoxy-3-[3-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]-1,2-benzoxazol-5-yl]propanoic acid (PubChem CID 142176289) has the molecular formula C22H22F3NO5 and a molecular weight of 437.41 g/mol. Its IUPAC name is 2-butoxy-3-[3-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]-1,2-benzoxazol-5-yl]propanoic acid.
| Compound Name | 2-butoxy-3-[3-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]-1,2-benzoxazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 142176289 |
| Molecular Formula | C22H22F3NO5 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-butoxy-3-[3-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]-1,2-benzoxazol-5-yl]propanoic acid |
| SMILES | CCCCOC(Cc1ccc2on(Cc3ccc(C(F)(F)F)cc3)c(=O)c2c1)C(=O)O |
| InChI | InChI=1S/C22H22F3NO5/c1-2-3-10-30-19(21(28)29)12-15-6-9-18-17(11-15)20(27)26(31-18)13-14-4-7-16(8-5-14)22(23,24)25/h4-9,11,19H,2-3,10,12-13H2,1H3,(H,28,29) |
| InChIKey | KQOZVPAHULGZPW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|