C24H29F3O5 — CID 139894771
2-hexoxy-3-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoic acid (PubChem CID 139894771) has the molecular formula C24H29F3O5 and a molecular weight of 454.49 g/mol. Its IUPAC name is 2-hexoxy-3-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoic acid.
| Compound Name | 2-hexoxy-3-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 139894771 |
| Molecular Formula | C24H29F3O5 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-hexoxy-3-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoic acid |
| SMILES | CCCCCCOC(Cc1ccc(OC)c(OCc2ccc(C(F)(F)F)cc2)c1)C(=O)O |
| InChI | InChI=1S/C24H29F3O5/c1-3-4-5-6-13-31-22(23(28)29)15-18-9-12-20(30-2)21(14-18)32-16-17-7-10-19(11-8-17)24(25,26)27/h7-12,14,22H,3-6,13,15-16H2,1-2H3,(H,28,29) |
| InChIKey | QDPCTZZVBTXGFT-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|