C22H25F3O4 — CID 154533761
ethyl 3-[4-methoxy-3-[2-[4-(trifluoromethyl)phenyl]ethoxy]phenyl]-2-methylpropanoate (PubChem CID 154533761) has the molecular formula C22H25F3O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is ethyl 3-[4-methoxy-3-[2-[4-(trifluoromethyl)phenyl]ethoxy]phenyl]-2-methylpropanoate.
| Compound Name | ethyl 3-[4-methoxy-3-[2-[4-(trifluoromethyl)phenyl]ethoxy]phenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 154533761 |
| Molecular Formula | C22H25F3O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | ethyl 3-[4-methoxy-3-[2-[4-(trifluoromethyl)phenyl]ethoxy]phenyl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)Cc1ccc(OC)c(OCCc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C22H25F3O4/c1-4-28-21(26)15(2)13-17-7-10-19(27-3)20(14-17)29-12-11-16-5-8-18(9-6-16)22(23,24)25/h5-10,14-15H,4,11-13H2,1-3H3 |
| InChIKey | NHGFKLKBRPHJGZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |