C22H26O7 — CID 139726344
2-(ethoxymethyl)-2-[[4-methoxy-3-(2-phenylethoxy)phenyl]methyl]propanedioic acid (PubChem CID 139726344) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is 2-(ethoxymethyl)-2-[[4-methoxy-3-(2-phenylethoxy)phenyl]methyl]propanedioic acid.
| Compound Name | 2-(ethoxymethyl)-2-[[4-methoxy-3-(2-phenylethoxy)phenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 139726344 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-(ethoxymethyl)-2-[[4-methoxy-3-(2-phenylethoxy)phenyl]methyl]propanedioic acid |
| SMILES | CCOCC(Cc1ccc(OC)c(OCCc2ccccc2)c1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C22H26O7/c1-3-28-15-22(20(23)24,21(25)26)14-17-9-10-18(27-2)19(13-17)29-12-11-16-7-5-4-6-8-16/h4-10,13H,3,11-12,14-15H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | IWIDRGURFZZQGC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|