C24H30O6 — CID 142630934
dimethyl 2-[[4-methoxy-3-(2-phenylethoxy)phenyl]methyl]-2-propylpropanedioate (PubChem CID 142630934) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is dimethyl 2-[[4-methoxy-3-(2-phenylethoxy)phenyl]methyl]-2-propylpropanedioate.
| Compound Name | dimethyl 2-[[4-methoxy-3-(2-phenylethoxy)phenyl]methyl]-2-propylpropanedioate |
|---|---|
| PubChem CID | 142630934 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | dimethyl 2-[[4-methoxy-3-(2-phenylethoxy)phenyl]methyl]-2-propylpropanedioate |
| SMILES | CCCC(Cc1ccc(OC)c(OCCc2ccccc2)c1)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C24H30O6/c1-5-14-24(22(25)28-3,23(26)29-4)17-19-11-12-20(27-2)21(16-19)30-15-13-18-9-7-6-8-10-18/h6-12,16H,5,13-15,17H2,1-4H3 |
| InChIKey | QOKNRPUXJYSRRE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|