C25H36O2 — CID 19606416
1-methoxy-4-(5-methyl-2-propylhexyl)-2-(2-phenylethoxy)benzene (PubChem CID 19606416) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is 1-methoxy-4-(5-methyl-2-propylhexyl)-2-(2-phenylethoxy)benzene.
| Compound Name | 1-methoxy-4-(5-methyl-2-propylhexyl)-2-(2-phenylethoxy)benzene |
|---|---|
| PubChem CID | 19606416 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 1-methoxy-4-(5-methyl-2-propylhexyl)-2-(2-phenylethoxy)benzene |
| SMILES | CCCC(CCC(C)C)Cc1ccc(OC)c(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C25H36O2/c1-5-9-22(13-12-20(2)3)18-23-14-15-24(26-4)25(19-23)27-17-16-21-10-7-6-8-11-21/h6-8,10-11,14-15,19-20,22H,5,9,12-13,16-18H2,1-4H3 |
| InChIKey | WQIHBLJNDRGDSV-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |