C19H24O4S — CID 20986503
3-(4-methoxy-3-pentoxyphenyl)-2-thiophen-2-ylpropanoic acid (PubChem CID 20986503) has the molecular formula C19H24O4S and a molecular weight of 348.46 g/mol. Its IUPAC name is 3-(4-methoxy-3-pentoxyphenyl)-2-thiophen-2-ylpropanoic acid.
| Compound Name | 3-(4-methoxy-3-pentoxyphenyl)-2-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 20986503 |
| Molecular Formula | C19H24O4S |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 3-(4-methoxy-3-pentoxyphenyl)-2-thiophen-2-ylpropanoic acid |
| SMILES | CCCCCOc1cc(CC(C(=O)O)c2cccs2)ccc1OC |
| InChI | InChI=1S/C19H24O4S/c1-3-4-5-10-23-17-13-14(8-9-16(17)22-2)12-15(19(20)21)18-7-6-11-24-18/h6-9,11,13,15H,3-5,10,12H2,1-2H3,(H,20,21) |
| InChIKey | WZKHVDHNSNPXQC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|