C18H22O3S — CID 22685131
3-(4-pentoxyphenyl)-2-thiophen-2-ylpropanoic acid (PubChem CID 22685131) has the molecular formula C18H22O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is 3-(4-pentoxyphenyl)-2-thiophen-2-ylpropanoic acid.
| Compound Name | 3-(4-pentoxyphenyl)-2-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 22685131 |
| Molecular Formula | C18H22O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 3-(4-pentoxyphenyl)-2-thiophen-2-ylpropanoic acid |
| SMILES | CCCCCOc1ccc(CC(C(=O)O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H22O3S/c1-2-3-4-11-21-15-9-7-14(8-10-15)13-16(18(19)20)17-6-5-12-22-17/h5-10,12,16H,2-4,11,13H2,1H3,(H,19,20) |
| InChIKey | IREBCDCIBQFSMV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|