C22H22O5S — CID 20990244
3-[4-methoxy-3-(2-phenoxyethoxy)phenyl]-2-thiophen-2-ylpropanoic acid (PubChem CID 20990244) has the molecular formula C22H22O5S and a molecular weight of 398.48 g/mol. Its IUPAC name is 3-[4-methoxy-3-(2-phenoxyethoxy)phenyl]-2-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[4-methoxy-3-(2-phenoxyethoxy)phenyl]-2-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 20990244 |
| Molecular Formula | C22H22O5S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 3-[4-methoxy-3-(2-phenoxyethoxy)phenyl]-2-thiophen-2-ylpropanoic acid |
| SMILES | COc1ccc(CC(C(=O)O)c2cccs2)cc1OCCOc1ccccc1 |
| InChI | InChI=1S/C22H22O5S/c1-25-19-10-9-16(14-18(22(23)24)21-8-5-13-28-21)15-20(19)27-12-11-26-17-6-3-2-4-7-17/h2-10,13,15,18H,11-12,14H2,1H3,(H,23,24) |
| InChIKey | AJWDPHLLGBPLSV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|