C14H14O4S — CID 22681173
3-(3-hydroxy-4-methoxyphenyl)-2-thiophen-2-ylpropanoic acid (PubChem CID 22681173) has the molecular formula C14H14O4S and a molecular weight of 278.33 g/mol. Its IUPAC name is 3-(3-hydroxy-4-methoxyphenyl)-2-thiophen-2-ylpropanoic acid.
| Compound Name | 3-(3-hydroxy-4-methoxyphenyl)-2-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 22681173 |
| Molecular Formula | C14H14O4S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 3-(3-hydroxy-4-methoxyphenyl)-2-thiophen-2-ylpropanoic acid |
| SMILES | COc1ccc(CC(C(=O)O)c2cccs2)cc1O |
| InChI | InChI=1S/C14H14O4S/c1-18-12-5-4-9(8-11(12)15)7-10(14(16)17)13-3-2-6-19-13/h2-6,8,10,15H,7H2,1H3,(H,16,17) |
| InChIKey | IFWDRJUWSGYSGL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |