C18H23NO3S — CID 22688049
3-[3-[3-(dimethylamino)propoxy]phenyl]-2-thiophen-2-ylpropanoic acid (PubChem CID 22688049) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is 3-[3-[3-(dimethylamino)propoxy]phenyl]-2-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[3-[3-(dimethylamino)propoxy]phenyl]-2-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 22688049 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 3-[3-[3-(dimethylamino)propoxy]phenyl]-2-thiophen-2-ylpropanoic acid |
| SMILES | CN(C)CCCOc1cccc(CC(C(=O)O)c2cccs2)c1 |
| InChI | InChI=1S/C18H23NO3S/c1-19(2)9-5-10-22-15-7-3-6-14(12-15)13-16(18(20)21)17-8-4-11-23-17/h3-4,6-8,11-12,16H,5,9-10,13H2,1-2H3,(H,20,21) |
| InChIKey | WGWYIAPQVDBARV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|