C19H25NO4S — CID 22681229
3-[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]-2-thiophen-2-ylpropanoic acid (PubChem CID 22681229) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is 3-[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]-2-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]-2-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 22681229 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 3-[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]-2-thiophen-2-ylpropanoic acid |
| SMILES | COc1cc(CC(C(=O)O)c2cccs2)ccc1OCCCN(C)C |
| InChI | InChI=1S/C19H25NO4S/c1-20(2)9-5-10-24-16-8-7-14(13-17(16)23-3)12-15(19(21)22)18-6-4-11-25-18/h4,6-8,11,13,15H,5,9-10,12H2,1-3H3,(H,21,22) |
| InChIKey | XWTVLXPMVCELBP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|