C23H24O4S — CID 20990776
3-[4-[2-(2,4-dimethylphenoxy)ethoxy]phenyl]-2-thiophen-2-ylpropanoic acid (PubChem CID 20990776) has the molecular formula C23H24O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is 3-[4-[2-(2,4-dimethylphenoxy)ethoxy]phenyl]-2-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[4-[2-(2,4-dimethylphenoxy)ethoxy]phenyl]-2-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 20990776 |
| Molecular Formula | C23H24O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 3-[4-[2-(2,4-dimethylphenoxy)ethoxy]phenyl]-2-thiophen-2-ylpropanoic acid |
| SMILES | Cc1ccc(OCCOc2ccc(CC(C(=O)O)c3cccs3)cc2)c(C)c1 |
| InChI | InChI=1S/C23H24O4S/c1-16-5-10-21(17(2)14-16)27-12-11-26-19-8-6-18(7-9-19)15-20(23(24)25)22-4-3-13-28-22/h3-10,13-14,20H,11-12,15H2,1-2H3,(H,24,25) |
| InChIKey | CWGWPJOVJZYZGD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|